C21H20N8OS — CID 117092176
4-[2-[[2-[(2-methylpyrazol-3-yl)amino]-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol (PubChem CID 117092176) has the molecular formula C21H20N8OS and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-[2-[[2-[(2-methylpyrazol-3-yl)amino]-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-[(2-methylpyrazol-3-yl)amino]-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117092176 |
| Molecular Formula | C21H20N8OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[2-[[2-[(2-methylpyrazol-3-yl)amino]-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol |
| SMILES | Cn1nccc1Nc1nc(NCCc2ccc(O)cc2)c2ncn(-c3ccsc3)c2n1 |
| InChI | InChI=1S/C21H20N8OS/c1-28-17(7-10-24-28)25-21-26-19(22-9-6-14-2-4-16(30)5-3-14)18-20(27-21)29(13-23-18)15-8-11-31-12-15/h2-5,7-8,10-13,30H,6,9H2,1H3,(H2,22,25,26,27) |
| InChIKey | QOIXXDPSQLEEND-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |