C23H20N8O — CID 117086418
4-[2-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]ethyl]phenol (PubChem CID 117086418) has the molecular formula C23H20N8O and a molecular weight of 424.47 g/mol. Its IUPAC name is 4-[2-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117086418 |
| Molecular Formula | C23H20N8O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 4-[2-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(Nc3ccncn3)nc3c2ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N8O/c32-18-8-6-16(7-9-18)10-13-25-21-20-22(31(15-27-20)17-4-2-1-3-5-17)30-23(29-21)28-19-11-12-24-14-26-19/h1-9,11-12,14-15,32H,10,13H2,(H2,24,25,26,28,29,30) |
| InChIKey | IEKMLBICYXULKU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |