C23H19N9O — CID 117079216
N-[4-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]phenyl]acetamide (PubChem CID 117079216) has the molecular formula C23H19N9O and a molecular weight of 437.47 g/mol. Its IUPAC name is N-[4-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117079216 |
| Molecular Formula | C23H19N9O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[4-[[9-phenyl-2-(pyrimidin-4-ylamino)purin-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Nc3ccncn3)nc3c2ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N9O/c1-15(33)27-16-7-9-17(10-8-16)28-21-20-22(32(14-26-20)18-5-3-2-4-6-18)31-23(30-21)29-19-11-12-24-13-25-19/h2-14H,1H3,(H,27,33)(H2,24,25,28,29,30,31) |
| InChIKey | MZNXTGMKYXMHBE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |