C25H29N7O4 — CID 117080857
N-[4-[[9-propan-2-yl-2-(3,4,5-trimethoxyanilino)purin-6-yl]amino]phenyl]acetamide (PubChem CID 117080857) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[4-[[9-propan-2-yl-2-(3,4,5-trimethoxyanilino)purin-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[9-propan-2-yl-2-(3,4,5-trimethoxyanilino)purin-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117080857 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[4-[[9-propan-2-yl-2-(3,4,5-trimethoxyanilino)purin-6-yl]amino]phenyl]acetamide |
| SMILES | COc1cc(Nc2nc(Nc3ccc(NC(C)=O)cc3)c3ncn(C(C)C)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H29N7O4/c1-14(2)32-13-26-21-23(28-17-9-7-16(8-10-17)27-15(3)33)30-25(31-24(21)32)29-18-11-19(34-4)22(36-6)20(12-18)35-5/h7-14H,1-6H3,(H,27,33)(H2,28,29,30,31) |
| InChIKey | IDJCAOQFCCUWPI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |