C27H33N7O4 — CID 117081196
2-N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine (PubChem CID 117081196) has the molecular formula C27H33N7O4 and a molecular weight of 519.61 g/mol. Its IUPAC name is 2-N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine.
| Compound Name | 2-N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117081196 |
| Molecular Formula | C27H33N7O4 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 2-N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
| SMILES | COc1cc(Nc2nc(Nc3ccc(N4CCOCC4)cc3)nc3c2ncn3C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C27H33N7O4/c1-17(2)34-16-28-23-25(29-19-14-21(35-3)24(37-5)22(15-19)36-4)31-27(32-26(23)34)30-18-6-8-20(9-7-18)33-10-12-38-13-11-33/h6-9,14-17H,10-13H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | WBQPHUTXWIMGRY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|