C26H32N6O6 — CID 117082482
9-propan-2-yl-2-N,6-N-bis(3,4,5-trimethoxyphenyl)purine-2,6-diamine (PubChem CID 117082482) has the molecular formula C26H32N6O6 and a molecular weight of 524.58 g/mol. Its IUPAC name is 9-propan-2-yl-2-N,6-N-bis(3,4,5-trimethoxyphenyl)purine-2,6-diamine.
| Compound Name | 9-propan-2-yl-2-N,6-N-bis(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117082482 |
| Molecular Formula | C26H32N6O6 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 9-propan-2-yl-2-N,6-N-bis(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
| SMILES | COc1cc(Nc2nc(Nc3cc(OC)c(OC)c(OC)c3)c3ncn(C(C)C)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N6O6/c1-14(2)32-13-27-21-24(28-15-9-17(33-3)22(37-7)18(10-15)34-4)30-26(31-25(21)32)29-16-11-19(35-5)23(38-8)20(12-16)36-6/h9-14H,1-8H3,(H2,28,29,30,31) |
| InChIKey | FHYFSBXUHBWKGG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |