C14H12Br2ClN5 — CID 176909183
2-chloro-N-(3,5-dibromophenyl)-9-propan-2-ylpurin-6-amine (PubChem CID 176909183) has the molecular formula C14H12Br2ClN5 and a molecular weight of 445.55 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dibromophenyl)-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-chloro-N-(3,5-dibromophenyl)-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 176909183 |
| Molecular Formula | C14H12Br2ClN5 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 442.91 |
| IUPAC Name | 2-chloro-N-(3,5-dibromophenyl)-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(Nc3cc(Br)cc(Br)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C14H12Br2ClN5/c1-7(2)22-6-18-11-12(20-14(17)21-13(11)22)19-10-4-8(15)3-9(16)5-10/h3-7H,1-2H3,(H,19,20,21) |
| InChIKey | JZTGRZQSINYGIC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |