C16H18ClN5 — CID 90956369
2-chloro-N-[(4-methylphenyl)methyl]-9-propan-2-ylpurin-6-amine (PubChem CID 90956369) has the molecular formula C16H18ClN5 and a molecular weight of 315.81 g/mol. Its IUPAC name is 2-chloro-N-[(4-methylphenyl)methyl]-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-chloro-N-[(4-methylphenyl)methyl]-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 90956369 |
| Molecular Formula | C16H18ClN5 |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-chloro-N-[(4-methylphenyl)methyl]-9-propan-2-ylpurin-6-amine |
| SMILES | Cc1ccc(CNc2nc(Cl)nc3c2ncn3C(C)C)cc1 |
| InChI | InChI=1S/C16H18ClN5/c1-10(2)22-9-19-13-14(20-16(17)21-15(13)22)18-8-12-6-4-11(3)5-7-12/h4-7,9-10H,8H2,1-3H3,(H,18,20,21) |
| InChIKey | SLCSXHFGRWRPIN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |