C19H24ClN5 — CID 170120595
2-chloro-9-hexan-2-yl-N-[(3-methylphenyl)methyl]purin-6-amine (PubChem CID 170120595) has the molecular formula C19H24ClN5 and a molecular weight of 357.89 g/mol. Its IUPAC name is 2-chloro-9-hexan-2-yl-N-[(3-methylphenyl)methyl]purin-6-amine.
| Compound Name | 2-chloro-9-hexan-2-yl-N-[(3-methylphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 170120595 |
| Molecular Formula | C19H24ClN5 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-chloro-9-hexan-2-yl-N-[(3-methylphenyl)methyl]purin-6-amine |
| SMILES | CCCCC(C)n1cnc2c(NCc3cccc(C)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C19H24ClN5/c1-4-5-8-14(3)25-12-22-16-17(23-19(20)24-18(16)25)21-11-15-9-6-7-13(2)10-15/h6-7,9-10,12,14H,4-5,8,11H2,1-3H3,(H,21,23,24) |
| InChIKey | HCKMGWZEXVHESJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |