C21H25ClN8 — CID 175875621
N-[[2-(3-tert-butylpyrazol-1-yl)-3-pyridinyl]methyl]-2-chloro-9-propan-2-ylpurin-6-amine (PubChem CID 175875621) has the molecular formula C21H25ClN8 and a molecular weight of 424.94 g/mol. Its IUPAC name is N-[[2-(3-tert-butylpyrazol-1-yl)-3-pyridinyl]methyl]-2-chloro-9-propan-2-ylpurin-6-amine.
| Compound Name | N-[[2-(3-tert-butylpyrazol-1-yl)-3-pyridinyl]methyl]-2-chloro-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 175875621 |
| Molecular Formula | C21H25ClN8 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[[2-(3-tert-butylpyrazol-1-yl)-3-pyridinyl]methyl]-2-chloro-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(NCc3cccnc3-n3ccc(C(C)(C)C)n3)nc(Cl)nc21 |
| InChI | InChI=1S/C21H25ClN8/c1-13(2)29-12-25-16-17(26-20(22)27-19(16)29)24-11-14-7-6-9-23-18(14)30-10-8-15(28-30)21(3,4)5/h6-10,12-13H,11H2,1-5H3,(H,24,26,27) |
| InChIKey | FIPIXDUOSLJXKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |