C20H22ClN5O3 — CID 167153092
[5-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 167153092) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is [5-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [5-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167153092 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [5-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCC(n2cnc3c(NCc4cccc(C)c4)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C20H22ClN5O3/c1-12-4-3-5-14(8-12)9-22-18-17-19(25-20(21)24-18)26(11-23-17)16-7-6-15(29-16)10-28-13(2)27/h3-5,8,11,15-16H,6-7,9-10H2,1-2H3,(H,22,24,25) |
| InChIKey | KBAUVZOVLSQOCY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |