C20H29ClN5O8P — CID 166644912
[5-[2-chloro-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxymethyl-(ethoxycarbonyloxymethoxy)phosphinic acid (PubChem CID 166644912) has the molecular formula C20H29ClN5O8P and a molecular weight of 533.91 g/mol. Its IUPAC name is [5-[2-chloro-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxymethyl-(ethoxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [5-[2-chloro-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxymethyl-(ethoxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 166644912 |
| Molecular Formula | C20H29ClN5O8P |
| Molecular Weight | 533.91 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [5-[2-chloro-6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxymethyl-(ethoxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CCOC(=O)OCOP(=O)(O)COCC1CCC(n2cnc3c(NC4CCCC4)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C20H29ClN5O8P/c1-2-31-20(27)32-11-33-35(28,29)12-30-9-14-7-8-15(34-14)26-10-22-16-17(23-13-5-3-4-6-13)24-19(21)25-18(16)26/h10,13-15H,2-9,11-12H2,1H3,(H,28,29)(H,23,24,25) |
| InChIKey | SFJHXFCCSKSVDV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|