C27H41ClN5O15P — CID 163960127
[[(3S,4R)-5-[[2-chloro-6-(cyclopentylamino)purin-9-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 163960127) has the molecular formula C27H41ClN5O15P and a molecular weight of 742.07 g/mol. Its IUPAC name is [[(3S,4R)-5-[[2-chloro-6-(cyclopentylamino)purin-9-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [[(3S,4R)-5-[[2-chloro-6-(cyclopentylamino)purin-9-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 163960127 |
| Molecular Formula | C27H41ClN5O15P |
| Molecular Weight | 742.07 g/mol |
| Exact Mass | 741.20 |
| IUPAC Name | [[(3S,4R)-5-[[2-chloro-6-(cyclopentylamino)purin-9-yl]methyl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOP(=O)(COCC1OC(Cn2cnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)OCOC(=O)OCCOC |
| InChI | InChI=1S/C27H41ClN5O15P/c1-39-7-9-42-26(36)44-14-46-49(38,47-15-45-27(37)43-10-8-40-2)16-41-12-19-22(35)21(34)18(48-19)11-33-13-29-20-23(30-17-5-3-4-6-17)31-25(28)32-24(20)33/h13,17-19,21-22,34-35H,3-12,14-16H2,1-2H3,(H,30,31,32)/t18?,19?,21-,22+/m0/s1 |
| InChIKey | SGSNKASGLTVBCX-IJZHQTRZSA-N |
| XLogP | 2.04 |
| TPSA | 239.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.07 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|