C30H47ClN5O13P — CID 154983659
[2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-bis(2,2-dimethylpropoxycarbonyloxy)propan-2-yl]phosphonic acid (PubChem CID 154983659) has the molecular formula C30H47ClN5O13P and a molecular weight of 752.15 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-bis(2,2-dimethylpropoxycarbonyloxy)propan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-bis(2,2-dimethylpropoxycarbonyloxy)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 154983659 |
| Molecular Formula | C30H47ClN5O13P |
| Molecular Weight | 752.15 g/mol |
| Exact Mass | 751.26 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-bis(2,2-dimethylpropoxycarbonyloxy)propan-2-yl]phosphonic acid |
| SMILES | CC(C)(C)COC(=O)OCC(COC(=O)OCC(C)(C)C)(OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C30H47ClN5O13P/c1-28(2,3)12-44-26(39)46-14-30(50(41,42)43,15-47-27(40)45-13-29(4,5)6)48-11-18-20(37)21(38)24(49-18)36-16-32-19-22(33-17-9-7-8-10-17)34-25(31)35-23(19)36/h16-18,20-21,24,37-38H,7-15H2,1-6H3,(H,33,34,35)(H2,41,42,43)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | NQFUVSIMDGBQFE-UMCMBGNQSA-N |
| XLogP | 3.74 |
| TPSA | 243.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|