C19H27ClN5O9P — CID 118469743
[(1R)-1-[[(2R,3R,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469743) has the molecular formula C19H27ClN5O9P and a molecular weight of 535.88 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3R,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3R,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469743 |
| Molecular Formula | C19H27ClN5O9P |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | [(1R)-1-[[(2R,3R,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@H](OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C19H27ClN5O9P/c1-2-32-17(28)18(35(29,30)31)33-7-10-12(26)13(27)16(34-10)25-8-21-11-14(22-9-5-3-4-6-9)23-19(20)24-15(11)25/h8-10,12-13,16,18,26-27H,2-7H2,1H3,(H,22,23,24)(H2,29,30,31)/t10-,12+,13-,16-,18-/m1/s1 |
| InChIKey | UCENYACNFGWDLQ-ZGWZXYFRSA-N |
| XLogP | 0.54 |
| TPSA | 198.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|