C12H15ClN5O9P — CID 118478549
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid (PubChem CID 118478549) has the molecular formula C12H15ClN5O9P and a molecular weight of 439.71 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 118478549 |
| Molecular Formula | C12H15ClN5O9P |
| Molecular Weight | 439.71 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(C(=O)O)P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15ClN5O9P/c13-12-16-7(14)4-8(17-12)18(2-15-4)9-6(20)5(19)3(27-9)1-26-11(10(21)22)28(23,24)25/h2-3,5-6,9,11,19-20H,1H2,(H,21,22)(H2,14,16,17)(H2,23,24,25)/t3-,5-,6-,9-,11?/m1/s1 |
| InChIKey | LBYMBTPZPDLDBZ-JPJRCZBHSA-N |
| XLogP | -1.71 |
| TPSA | 223.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.71 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|