C14H19ClN5O9P — CID 118469542
[1-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469542) has the molecular formula C14H19ClN5O9P and a molecular weight of 467.76 g/mol. Its IUPAC name is [1-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469542 |
| Molecular Formula | C14H19ClN5O9P |
| Molecular Weight | 467.76 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [1-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)C(OCC1OC(n2cnc3c(N)nc(Cl)nc32)C(O)C1O)P(=O)(O)O |
| InChI | InChI=1S/C14H19ClN5O9P/c1-2-27-12(23)13(30(24,25)26)28-3-5-7(21)8(22)11(29-5)20-4-17-6-9(16)18-14(15)19-10(6)20/h4-5,7-8,11,13,21-22H,2-3H2,1H3,(H2,16,18,19)(H2,24,25,26) |
| InChIKey | HLSBAZQWKLXXBL-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.76 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|