C15H21ClN5O9P — CID 118469398
[(1R)-1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469398) has the molecular formula C15H21ClN5O9P and a molecular weight of 481.79 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469398 |
| Molecular Formula | C15H21ClN5O9P |
| Molecular Weight | 481.79 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | [(1R)-1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@H](OC[C@H]1O[C@@H](n2cnc3c(NC)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C15H21ClN5O9P/c1-3-28-13(24)14(31(25,26)27)29-4-6-8(22)9(23)12(30-6)21-5-18-7-10(17-2)19-15(16)20-11(7)21/h5-6,8-9,12,14,22-23H,3-4H2,1-2H3,(H,17,19,20)(H2,25,26,27)/t6-,8-,9-,12-,14-/m1/s1 |
| InChIKey | PJZONLYMBAOUFC-CPUOEAAZSA-N |
| XLogP | -0.78 |
| TPSA | 198.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.79 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|