C15H19ClN3O9P — CID 118469758
[(1S)-1-[[(2R,3R,4R,5R)-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469758) has the molecular formula C15H19ClN3O9P and a molecular weight of 451.76 g/mol. Its IUPAC name is [(1S)-1-[[(2R,3R,4R,5R)-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1S)-1-[[(2R,3R,4R,5R)-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469758 |
| Molecular Formula | C15H19ClN3O9P |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [(1S)-1-[[(2R,3R,4R,5R)-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@@H](OC[C@H]1O[C@@H](n2cnc3ccc(Cl)nc32)[C@H](O)[C@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C15H19ClN3O9P/c1-2-26-14(22)15(29(23,24)25)27-5-8-10(20)11(21)13(28-8)19-6-17-7-3-4-9(16)18-12(7)19/h3-4,6,8,10-11,13,15,20-21H,2,5H2,1H3,(H2,23,24,25)/t8-,10+,11-,13-,15+/m1/s1 |
| InChIKey | PUPOQLUMTVBPDM-QTRGNSQVSA-N |
| XLogP | -0.21 |
| TPSA | 173.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|