C15H20ClN4O9P — CID 118469629
[(1R)-1-[[(2R,3S,4R,5R)-5-(2-chloro-6-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469629) has the molecular formula C15H20ClN4O9P and a molecular weight of 466.77 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3S,4R,5R)-5-(2-chloro-6-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3S,4R,5R)-5-(2-chloro-6-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469629 |
| Molecular Formula | C15H20ClN4O9P |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | [(1R)-1-[[(2R,3S,4R,5R)-5-(2-chloro-6-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@H](OC[C@H]1O[C@@H](n2cnc3c(C)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C15H20ClN4O9P/c1-3-27-13(23)14(30(24,25)26)28-4-7-9(21)10(22)12(29-7)20-5-17-8-6(2)18-15(16)19-11(8)20/h5,7,9-10,12,14,21-22H,3-4H2,1-2H3,(H2,24,25,26)/t7-,9-,10-,12-,14-/m1/s1 |
| InChIKey | SRNWTPXMXCSNNO-WEUFEVMQSA-N |
| XLogP | -0.51 |
| TPSA | 186.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|