C15H20ClN4O7P — CID 144952602
[(1R)-1-[[(2S,5R)-5-(2-chloro-6-methylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 144952602) has the molecular formula C15H20ClN4O7P and a molecular weight of 434.77 g/mol. Its IUPAC name is [(1R)-1-[[(2S,5R)-5-(2-chloro-6-methylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S,5R)-5-(2-chloro-6-methylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 144952602 |
| Molecular Formula | C15H20ClN4O7P |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [(1R)-1-[[(2S,5R)-5-(2-chloro-6-methylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@H](OC[C@@H]1CC[C@H](n2cnc3c(C)nc(Cl)nc32)O1)P(=O)(O)O |
| InChI | InChI=1S/C15H20ClN4O7P/c1-3-25-13(21)14(28(22,23)24)26-6-9-4-5-10(27-9)20-7-17-11-8(2)18-15(16)19-12(11)20/h7,9-10,14H,3-6H2,1-2H3,(H2,22,23,24)/t9-,10+,14+/m0/s1 |
| InChIKey | AUYQJKUQUPEXAG-IMSIIYSGSA-N |
| XLogP | 1.55 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|