C15H22N5O7PS — CID 156543824
[1-[[(5R)-5-(6-amino-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 156543824) has the molecular formula C15H22N5O7PS and a molecular weight of 447.41 g/mol. Its IUPAC name is [1-[[(5R)-5-(6-amino-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[(5R)-5-(6-amino-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 156543824 |
| Molecular Formula | C15H22N5O7PS |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [1-[[(5R)-5-(6-amino-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)C(OCC1CC[C@H](n2cnc3c(N)nc(SC)nc32)O1)P(=O)(O)O |
| InChI | InChI=1S/C15H22N5O7PS/c1-3-25-13(21)14(28(22,23)24)26-6-8-4-5-9(27-8)20-7-17-10-11(16)18-15(29-2)19-12(10)20/h7-9,14H,3-6H2,1-2H3,(H2,16,18,19)(H2,22,23,24)/t8?,9-,14?/m1/s1 |
| InChIKey | HJUFPNPXOWLINM-ZYTOWTHASA-N |
| XLogP | 0.89 |
| TPSA | 171.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|