C14H21FN5O5P — CID 169190106
acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate;ethane (PubChem CID 169190106) has the molecular formula C14H21FN5O5P and a molecular weight of 389.32 g/mol. Its IUPAC name is acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate;ethane.
| Compound Name | acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate;ethane |
|---|---|
| PubChem CID | 169190106 |
| Molecular Formula | C14H21FN5O5P |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | acetylene;[5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate;ethane |
| SMILES | C#C.CC.Nc1nc(F)nc2c1ncn2C1CCC(COP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H13FN5O5P.C2H6.C2H2/c11-10-14-8(12)7-9(15-10)16(4-13-7)6-2-1-5(21-6)3-20-22(17,18)19;2*1-2/h4-6H,1-3H2,(H2,12,14,15)(H2,17,18,19);1-2H3;1-2H |
| InChIKey | CFOGUMVPNQUOHM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|