C10H12FN5O2 — CID 153392880
[(2S)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 153392880) has the molecular formula C10H12FN5O2 and a molecular weight of 253.24 g/mol. Its IUPAC name is [(2S)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 153392880 |
| Molecular Formula | C10H12FN5O2 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [(2S)-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | Nc1nc(F)nc2c1ncn2C1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12FN5O2/c11-10-14-8(12)7-9(15-10)16(4-13-7)6-2-1-5(3-17)18-6/h4-6,17H,1-3H2,(H2,12,14,15)/t5-,6?/m0/s1 |
| InChIKey | OGSWGOOQBBYAIG-ZBHICJROSA-N |
| XLogP | 0.22 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |