C10H14N6O2 — CID 135258315
[(2S,5R)-5-(6-hydrazinylpurin-9-yl)oxolan-2-yl]methanol (PubChem CID 135258315) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is [(2S,5R)-5-(6-hydrazinylpurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(6-hydrazinylpurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 135258315 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(2S,5R)-5-(6-hydrazinylpurin-9-yl)oxolan-2-yl]methanol |
| SMILES | NNc1ncnc2c1ncn2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H14N6O2/c11-15-9-8-10(13-4-12-9)16(5-14-8)7-2-1-6(3-17)18-7/h4-7,17H,1-3,11H2,(H,12,13,15)/t6-,7+/m0/s1 |
| InChIKey | RCASPGALMFTOQU-NKWVEPMBSA-N |
| XLogP | -0.22 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|