C16H23N5O2 — CID 54592375
[(2R,5R)-5-[6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol (PubChem CID 54592375) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is [(2R,5R)-5-[6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol.
| Compound Name | [(2R,5R)-5-[6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 54592375 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | [(2R,5R)-5-[6-(cyclohexylamino)purin-9-yl]oxolan-2-yl]methanol |
| SMILES | OC[C@H]1CC[C@H](n2cnc3c(NC4CCCCC4)ncnc32)O1 |
| InChI | InChI=1S/C16H23N5O2/c22-8-12-6-7-13(23-12)21-10-19-14-15(17-9-18-16(14)21)20-11-4-2-1-3-5-11/h9-13,22H,1-8H2,(H,17,18,20)/t12-,13-/m1/s1 |
| InChIKey | VNLBSPUULCIVCQ-CHWSQXEVSA-N |
| XLogP | 2.24 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |