C17H19N5O2 — CID 142470459
[(5R)-5-[6-(benzylamino)purin-9-yl]oxolan-2-yl]methanol (PubChem CID 142470459) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is [(5R)-5-[6-(benzylamino)purin-9-yl]oxolan-2-yl]methanol.
| Compound Name | [(5R)-5-[6-(benzylamino)purin-9-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 142470459 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [(5R)-5-[6-(benzylamino)purin-9-yl]oxolan-2-yl]methanol |
| SMILES | OCC1CC[C@H](n2cnc3c(NCc4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C17H19N5O2/c23-9-13-6-7-14(24-13)22-11-21-15-16(19-10-20-17(15)22)18-8-12-4-2-1-3-5-12/h1-5,10-11,13-14,23H,6-9H2,(H,18,19,20)/t13?,14-/m1/s1 |
| InChIKey | FTFUACKLTUPQQG-ARLHGKGLSA-N |
| XLogP | 2.11 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |