C14H13N5O — CID 174692063
N-benzyl-9-(oxiran-2-yl)purin-6-amine (PubChem CID 174692063) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-benzyl-9-(oxiran-2-yl)purin-6-amine.
| Compound Name | N-benzyl-9-(oxiran-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 174692063 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-benzyl-9-(oxiran-2-yl)purin-6-amine |
| SMILES | c1ccc(CNc2ncnc3c2ncn3C2CO2)cc1 |
| InChI | InChI=1S/C14H13N5O/c1-2-4-10(5-3-1)6-15-13-12-14(17-8-16-13)19(9-18-12)11-7-20-11/h1-5,8-9,11H,6-7H2,(H,15,16,17) |
| InChIKey | WOBHQEQIUNUXPD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|