C17H20N6O5S — CID 121440976
[(2S,3S)-5-[6-(benzylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 121440976) has the molecular formula C17H20N6O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is [(2S,3S)-5-[6-(benzylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2S,3S)-5-[6-(benzylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 121440976 |
| Molecular Formula | C17H20N6O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [(2S,3S)-5-[6-(benzylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@@H]1OC(n2cnc3c(NCc4ccccc4)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C17H20N6O5S/c18-29(25,26)27-8-13-12(24)6-14(28-13)23-10-22-15-16(20-9-21-17(15)23)19-7-11-4-2-1-3-5-11/h1-5,9-10,12-14,24H,6-8H2,(H2,18,25,26)(H,19,20,21)/t12-,13-,14?/m0/s1 |
| InChIKey | HRAZQFYHJNEEBD-RFHHWMCGSA-N |
| XLogP | 0.31 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |