C24H23N5O5 — CID 66842738
[(2R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl benzoate (PubChem CID 66842738) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is [(2R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 66842738 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [(2R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C24H23N5O5/c30-19-17(12-33-24(32)16-9-5-2-6-10-16)34-23(20(19)31)29-14-28-18-21(26-13-27-22(18)29)25-11-15-7-3-1-4-8-15/h1-10,13-14,17,19-20,23,30-31H,11-12H2,(H,25,26,27)/t17-,19?,20?,23-/m1/s1 |
| InChIKey | QJVIZHHZNASRPP-AGTGTDPFSA-N |
| XLogP | 1.91 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |