C16H15N5O4 — CID 155937194
[(2R,4R)-4-(6-aminopurin-9-yl)-3-hydroxyoxetan-2-yl]methyl benzoate (PubChem CID 155937194) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is [(2R,4R)-4-(6-aminopurin-9-yl)-3-hydroxyoxetan-2-yl]methyl benzoate.
| Compound Name | [(2R,4R)-4-(6-aminopurin-9-yl)-3-hydroxyoxetan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 155937194 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [(2R,4R)-4-(6-aminopurin-9-yl)-3-hydroxyoxetan-2-yl]methyl benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)C1O |
| InChI | InChI=1S/C16H15N5O4/c17-13-11-14(19-7-18-13)21(8-20-11)15-12(22)10(25-15)6-24-16(23)9-4-2-1-3-5-9/h1-5,7-8,10,12,15,22H,6H2,(H2,17,18,19)/t10-,12?,15-/m1/s1 |
| InChIKey | WVXDGFUDPHMQEB-KCOKAVLFSA-N |
| XLogP | 0.52 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |