C11H15N7O5 — CID 10734828
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-aminocarbamate (PubChem CID 10734828) has the molecular formula C11H15N7O5 and a molecular weight of 325.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-aminocarbamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-aminocarbamate |
|---|---|
| PubChem CID | 10734828 |
| Molecular Formula | C11H15N7O5 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-aminocarbamate |
| SMILES | NNC(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N7O5/c12-8-5-9(15-2-14-8)18(3-16-5)10-7(20)6(19)4(23-10)1-22-11(21)17-13/h2-4,6-7,10,19-20H,1,13H2,(H,17,21)(H2,12,14,15)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | PJMMYQUNUHPKNM-KQYNXXCUSA-N |
| XLogP | -2.37 |
| TPSA | 183.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|