C10H14Li2N5O7P — CID 131877550
CID 131877550 (PubChem CID 131877550) has the molecular formula C10H14Li2N5O7P and a molecular weight of 361.11 g/mol.
| Compound Name | CID 131877550 |
|---|---|
| PubChem CID | 131877550 |
| Molecular Formula | C10H14Li2N5O7P |
| Molecular Weight | 361.11 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O.[Li].[Li] |
| InChI | InChI=1S/C10H14N5O7P.2Li/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);;/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | FDZFVBUPXWQLRH-IDIVVRGQSA-N |
| XLogP | -2.62 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.11 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|