C16H28N5O13P — CID 67908290
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol (PubChem CID 67908290) has the molecular formula C16H28N5O13P and a molecular weight of 529.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 67908290 |
| Molecular Formula | C16H28N5O13P |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H14N5O7P.C6H14O6/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;7-1-3(9)5(11)6(12)4(10)2-8/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);3-12H,1-2H2/t4-,6-,7-,10-;3-,4-,5-,6-/m11/s1 |
| InChIKey | WNFRAWJDRIUPTP-YUXKZNNCSA-N |
| XLogP | -5.45 |
| TPSA | 307.45 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|