C15H23N5O14P2 — CID 54135460
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] phosphate (PubChem CID 54135460) has the molecular formula C15H23N5O14P2 and a molecular weight of 559.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] phosphate |
|---|---|
| PubChem CID | 54135460 |
| Molecular Formula | C15H23N5O14P2 |
| Molecular Weight | 559.32 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O[C@@H](C=O)[C@H](O)[C@H](O)CO)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23N5O14P2/c16-13-9-14(18-4-17-13)20(5-19-9)15-12(26)11(25)8(32-15)3-31-36(30,34-35(27,28)29)33-7(2-22)10(24)6(23)1-21/h2,4-8,10-12,15,21,23-26H,1,3H2,(H2,16,17,18)(H2,27,28,29)/t6-,7+,8-,10-,11-,12-,15-,36?/m1/s1 |
| InChIKey | NXJIVFHQCWQTFX-IPWHWMAASA-N |
| XLogP | -3.44 |
| TPSA | 299.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.32 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|