C10H15KN5O10P2 — CID 86670883
ADP monopotassium (PubChem CID 86670883) has the molecular formula C10H15KN5O10P2 and a molecular weight of 466.30 g/mol.
| Compound Name | ADP monopotassium |
|---|---|
| PubChem CID | 86670883 |
| Molecular Formula | C10H15KN5O10P2 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O.[K] |
| InChI | InChI=1S/C10H15N5O10P2.K/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20;/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20);/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | UXPQJISFYLAMBZ-MCDZGGTQSA-N |
| XLogP | -2.13 |
| TPSA | 232.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|