C20H29LiN10O22P5 — CID 172640163
CID 172640163 (PubChem CID 172640163) has the molecular formula C20H29LiN10O22P5 and a molecular weight of 923.31 g/mol.
| Compound Name | CID 172640163 |
|---|---|
| PubChem CID | 172640163 |
| Molecular Formula | C20H29LiN10O22P5 |
| Molecular Weight | 923.31 g/mol |
| Exact Mass | 923.03 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)C(O)C2O)C(O)C1O.[Li] |
| InChI | InChI=1S/C20H29N10O22P5.Li/c21-15-9-17(25-3-23-15)29(5-27-9)19-13(33)11(31)7(47-19)1-45-53(35,36)49-55(39,40)51-57(43,44)52-56(41,42)50-54(37,38)46-2-8-12(32)14(34)20(48-8)30-6-28-10-16(22)24-4-26-18(10)30;/h3-8,11-14,19-20,31-34H,1-2H2,(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H2,21,23,25)(H2,22,24,26); |
| InChIKey | LPQFLASWYGPZQR-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 480.50 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.31 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|