C10H16MgN5O13P3 — CID 171714189
ATP (magnesium) (PubChem CID 171714189) has the molecular formula C10H16MgN5O13P3 and a molecular weight of 531.49 g/mol.
| Compound Name | ATP (magnesium) |
|---|---|
| PubChem CID | 171714189 |
| Molecular Formula | C10H16MgN5O13P3 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 530.98 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)C1O.[Mg] |
| InChI | InChI=1S/C10H16N5O13P3.Mg/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20;/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20);/t4-,6+,7?,10-;/m1./s1 |
| InChIKey | KLHMIKHPGKEVJX-WFMVIYMNSA-N |
| XLogP | -2.01 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|