C10H18N5O19P5 — CID 175244085
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl bis[hydroxy(phosphonooxy)phosphoryl] phosphate (PubChem CID 175244085) has the molecular formula C10H18N5O19P5 and a molecular weight of 667.14 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl bis[hydroxy(phosphonooxy)phosphoryl] phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl bis[hydroxy(phosphonooxy)phosphoryl] phosphate |
|---|---|
| PubChem CID | 175244085 |
| Molecular Formula | C10H18N5O19P5 |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.93 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl bis[hydroxy(phosphonooxy)phosphoryl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(OP(=O)(O)OP(=O)(O)O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18N5O19P5/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(30-10)1-29-39(28,33-37(24,25)31-35(18,19)20)34-38(26,27)32-36(21,22)23/h2-4,6-7,10,16-17H,1H2,(H,24,25)(H,26,27)(H2,11,12,13)(H2,18,19,20)(H2,21,22,23)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | KTQTXNKKUUWSCM-KQYNXXCUSA-N |
| XLogP | -1.39 |
| TPSA | 372.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|