C10H17N5O13P4 — CID 174633676
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphanyl phosphate (PubChem CID 174633676) has the molecular formula C10H17N5O13P4 and a molecular weight of 539.16 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphanyl phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphanyl phosphate |
|---|---|
| PubChem CID | 174633676 |
| Molecular Formula | C10H17N5O13P4 |
| Molecular Weight | 539.16 g/mol |
| Exact Mass | 538.98 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] phosphanyl phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(OP)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H17N5O13P4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(25-10)1-24-32(23,26-29)28-31(21,22)27-30(18,19)20/h2-4,6-7,10,16-17H,1,29H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-,32?/m1/s1 |
| InChIKey | OUXMWRPFMVKDJU-NRSRKINISA-N |
| XLogP | -0.81 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|