C10H15BN5O12P3 — CID 153463707
CID 153463707 (PubChem CID 153463707) has the molecular formula C10H15BN5O12P3 and a molecular weight of 500.99 g/mol.
| Compound Name | CID 153463707 |
|---|---|
| PubChem CID | 153463707 |
| Molecular Formula | C10H15BN5O12P3 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | — |
| SMILES | [B]P(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)C1O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H15BN5O12P3/c11-29(19,27-31(23,24)28-30(20,21)22)25-1-4-6(17)7(18)10(26-4)16-3-15-5-8(12)13-2-14-9(5)16/h2-4,6-7,10,17-18H,1H2,(H,23,24)(H2,12,13,14)(H2,20,21,22)/t4-,6?,7+,10-,29?/m1/s1 |
| InChIKey | AQKWYEGKHUCWSY-DFXHNDQWSA-N |
| XLogP | -1.45 |
| TPSA | 258.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|