C10H19N5O14P3Se — CID 87536739
CID 87536739 (PubChem CID 87536739) has the molecular formula C10H19N5O14P3Se and a molecular weight of 605.16 g/mol.
| Compound Name | CID 87536739 |
|---|---|
| PubChem CID | 87536739 |
| Molecular Formula | C10H19N5O14P3Se |
| Molecular Weight | 605.16 g/mol |
| Exact Mass | 605.93 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O.O=P(O)(O)O.O=P(O)(O)[Se] |
| InChI | InChI=1S/C10H14N5O7P.H3O4P.H2O3PSe/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;1-5(2,3)4;1-4(2,3)5/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);(H3,1,2,3,4);(H2,1,2,3)/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | SBGKFBBUQHJPOQ-IDIVVRGQSA-N |
| XLogP | -3.54 |
| TPSA | 321.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.16 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|