C10H15N5NaO7P — CID 154734105
sodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride (PubChem CID 154734105) has the molecular formula C10H15N5NaO7P and a molecular weight of 371.22 g/mol. Its IUPAC name is sodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride.
| Compound Name | sodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 154734105 |
| Molecular Formula | C10H15N5NaO7P |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | sodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O.[H-].[Na+] |
| InChI | InChI=1S/C10H14N5O7P.Na.H/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);;/q;+1;-1/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | UDKVHGHSTZTTKA-IDIVVRGQSA-N |
| XLogP | -4.75 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|