C10H12N6O6 — CID 46874349
[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl nitrate (PubChem CID 46874349) has the molecular formula C10H12N6O6 and a molecular weight of 312.24 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl nitrate.
| Compound Name | [(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl nitrate |
|---|---|
| PubChem CID | 46874349 |
| Molecular Formula | C10H12N6O6 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl nitrate |
| SMILES | Nc1ncnc2c1ncn2C1O[C@H](CO[N+](=O)[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N6O6/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(22-10)1-21-16(19)20/h2-4,6-7,10,17-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10?/m1/s1 |
| InChIKey | QQVLEBJNJDLCJQ-VTHZCTBJSA-N |
| XLogP | -1.76 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|