C20H24N10O10P- — CID 23421155
bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate (PubChem CID 23421155) has the molecular formula C20H24N10O10P- and a molecular weight of 595.45 g/mol. Its IUPAC name is bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate.
| Compound Name | bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate |
|---|---|
| PubChem CID | 23421155 |
| Molecular Formula | C20H24N10O10P- |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25N10O10P/c21-15-9-17(25-3-23-15)29(5-27-9)19-13(33)11(31)7(39-19)1-37-41(35,36)38-2-8-12(32)14(34)20(40-8)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-34H,1-2H2,(H,35,36)(H2,21,23,25)(H2,22,24,26)/p-1/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | BHANORHBGGAOIV-XPWFQUROSA-M |
| XLogP | -3.43 |
| TPSA | 297.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|