C15H25N6O7P — CID 69477613
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 69477613) has the molecular formula C15H25N6O7P and a molecular weight of 432.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 69477613 |
| Molecular Formula | C15H25N6O7P |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H25N6O7P/c1-21(2,3)4-5-26-29(24,25)27-6-9-11(22)12(23)15(28-9)20-8-19-10-13(16)17-7-18-14(10)20/h7-9,11-12,15,22-23H,4-6H2,1-3H3,(H2-,16,17,18,24,25)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | YRWLALOXFZERNQ-SDBHATRESA-N |
| XLogP | -1.76 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|