C20H24N10O9Se — CID 86269846
bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] selenite (PubChem CID 86269846) has the molecular formula C20H24N10O9Se and a molecular weight of 627.43 g/mol. Its IUPAC name is bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] selenite.
| Compound Name | bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] selenite |
|---|---|
| PubChem CID | 86269846 |
| Molecular Formula | C20H24N10O9Se |
| Molecular Weight | 627.43 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | bis[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] selenite |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[Se](=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H24N10O9Se/c21-15-9-17(25-3-23-15)29(5-27-9)19-13(33)11(31)7(38-19)1-36-40(35)37-2-8-12(32)14(34)20(39-8)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-34H,1-2H2,(H2,21,23,25)(H2,22,24,26)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | HMFOGWVOOYYLLV-XPWFQUROSA-N |
| XLogP | -3.48 |
| TPSA | 274.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.43 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|