C10H15N5O7P+ — CID 175017666
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium;hydrate (PubChem CID 175017666) has the molecular formula C10H15N5O7P+ and a molecular weight of 348.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium;hydrate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium;hydrate |
|---|---|
| PubChem CID | 175017666 |
| Molecular Formula | C10H15N5O7P+ |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium;hydrate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[P+](=O)O)[C@@H](O)[C@H]1O.O |
| InChI | InChI=1S/C10H12N5O6P.H2O/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(21-10)1-20-22(18)19;/h2-4,6-7,10,16-17H,1H2,(H2-,11,12,13,18,19);1H2/p+1/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | BLZPCHFRKUQBNW-MCDZGGTQSA-O |
| XLogP | -2.13 |
| TPSA | 197.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|