C10H13N5O5P+ — CID 14823978
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 14823978) has the molecular formula C10H13N5O5P+ and a molecular weight of 314.22 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 14823978 |
| Molecular Formula | C10H13N5O5P+ |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO[P+](=O)O)O1 |
| InChI | InChI=1S/C10H12N5O5P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(20-7)2-19-21(17)18/h3-7,16H,1-2H2,(H2-,11,12,13,17,18)/p+1/t5-,6+,7+/m0/s1 |
| InChIKey | ZYGKBPNBRVPXME-RRKCRQDMSA-O |
| XLogP | -0.28 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|