C11H16N5O5P — CID 88971157
[(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 88971157) has the molecular formula C11H16N5O5P and a molecular weight of 329.25 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 88971157 |
| Molecular Formula | C11H16N5O5P |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)CC1O |
| InChI | InChI=1S/C11H16N5O5P/c1-22(18,19)20-3-7-6(17)2-8(21-7)16-5-15-9-10(12)13-4-14-11(9)16/h4-8,17H,2-3H2,1H3,(H,18,19)(H2,12,13,14)/t6?,7-,8-/m1/s1 |
| InChIKey | YNCYIAAXFUCITC-SPDVFEMOSA-N |
| XLogP | -0.11 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|